C26H37N3O4 — CID 54131410
N-[2-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]hexanamide (PubChem CID 54131410) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-[2-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]hexanamide.
| Compound Name | N-[2-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]hexanamide |
|---|---|
| PubChem CID | 54131410 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | N-[2-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccccc1OCC(O)CN1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C26H37N3O4/c1-3-4-5-14-26(31)27-22-10-6-8-12-24(22)33-20-21(30)19-28-15-17-29(18-16-28)23-11-7-9-13-25(23)32-2/h6-13,21,30H,3-5,14-20H2,1-2H3,(H,27,31) |
| InChIKey | NUQDWLUOKQJIMU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|