C22H29N3O5 — CID 102504727
methyl N-[4-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]carbamate (PubChem CID 102504727) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl N-[4-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]carbamate.
| Compound Name | methyl N-[4-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 102504727 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | methyl N-[4-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(OCC(O)CN2CCN(c3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O5/c1-28-21-6-4-3-5-20(21)25-13-11-24(12-14-25)15-18(26)16-30-19-9-7-17(8-10-19)23-22(27)29-2/h3-10,18,26H,11-16H2,1-2H3,(H,23,27) |
| InChIKey | CCSQKDOWWWCTNV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |