C22H30N3O4+ — CID 7125202
N-[4-[(2R)-2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propoxy]phenyl]acetamide (PubChem CID 7125202) has the molecular formula C22H30N3O4+ and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[4-[(2R)-2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propoxy]phenyl]acetamide.
| Compound Name | N-[4-[(2R)-2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 7125202 |
| Molecular Formula | C22H30N3O4+ |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N-[4-[(2R)-2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propoxy]phenyl]acetamide |
| SMILES | COc1ccccc1N1CC[NH+](C[C@@H](O)COc2ccc(NC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C22H29N3O4/c1-17(26)23-18-7-9-20(10-8-18)29-16-19(27)15-24-11-13-25(14-12-24)21-5-3-4-6-22(21)28-2/h3-10,19,27H,11-16H2,1-2H3,(H,23,26)/p+1/t19-/m1/s1 |
| InChIKey | UYHGXXBHBCRFFU-LJQANCHMSA-O |
| XLogP | 0.80 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |