C23H31N3O5 — CID 102504728
ethyl N-[4-[2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]carbamate (PubChem CID 102504728) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl N-[4-[2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]carbamate.
| Compound Name | ethyl N-[4-[2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 102504728 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | ethyl N-[4-[2-hydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(OCC(O)CN2CCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O5/c1-3-30-23(28)24-18-4-8-22(9-5-18)31-17-20(27)16-25-12-14-26(15-13-25)19-6-10-21(29-2)11-7-19/h4-11,20,27H,3,12-17H2,1-2H3,(H,24,28) |
| InChIKey | ABVCPOQVLMJESQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|