C20H24Cl2N4O3 — CID 67250924
[4-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]phenyl]urea (PubChem CID 67250924) has the molecular formula C20H24Cl2N4O3 and a molecular weight of 439.34 g/mol. Its IUPAC name is [4-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]phenyl]urea.
| Compound Name | [4-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]phenyl]urea |
|---|---|
| PubChem CID | 67250924 |
| Molecular Formula | C20H24Cl2N4O3 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [4-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(OCC(O)CN2CCN(c3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H24Cl2N4O3/c21-18-6-3-15(11-19(18)22)26-9-7-25(8-10-26)12-16(27)13-29-17-4-1-14(2-5-17)24-20(23)28/h1-6,11,16,27H,7-10,12-13H2,(H3,23,24,28) |
| InChIKey | XGEAVIAZYCTOFV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |