C20H26N4O4 — CID 67249537
[4-[2-hydroxy-3-[4-(4-hydroxyphenyl)piperazin-1-yl]propoxy]phenyl]urea (PubChem CID 67249537) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is [4-[2-hydroxy-3-[4-(4-hydroxyphenyl)piperazin-1-yl]propoxy]phenyl]urea.
| Compound Name | [4-[2-hydroxy-3-[4-(4-hydroxyphenyl)piperazin-1-yl]propoxy]phenyl]urea |
|---|---|
| PubChem CID | 67249537 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | [4-[2-hydroxy-3-[4-(4-hydroxyphenyl)piperazin-1-yl]propoxy]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(OCC(O)CN2CCN(c3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O4/c21-20(27)22-15-1-7-19(8-2-15)28-14-18(26)13-23-9-11-24(12-10-23)16-3-5-17(25)6-4-16/h1-8,18,25-26H,9-14H2,(H3,21,22,27) |
| InChIKey | FYVNOSFKOQSYPL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |