C23H30FN3O4 — CID 86577810
[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl] N-(4-propoxyphenyl)carbamate (PubChem CID 86577810) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is [3-[4-(4-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl] N-(4-propoxyphenyl)carbamate.
| Compound Name | [3-[4-(4-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl] N-(4-propoxyphenyl)carbamate |
|---|---|
| PubChem CID | 86577810 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | [3-[4-(4-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl] N-(4-propoxyphenyl)carbamate |
| SMILES | CCCOc1ccc(NC(=O)OCC(O)CN2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H30FN3O4/c1-2-15-30-22-9-5-19(6-10-22)25-23(29)31-17-21(28)16-26-11-13-27(14-12-26)20-7-3-18(24)4-8-20/h3-10,21,28H,2,11-17H2,1H3,(H,25,29) |
| InChIKey | YDRGJQZXTKITGE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |