C31H39N3O4 — CID 10392895
butyl N-[4-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]carbamate (PubChem CID 10392895) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is butyl N-[4-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]carbamate.
| Compound Name | butyl N-[4-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 10392895 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | butyl N-[4-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(OCC(O)CN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H39N3O4/c1-2-3-22-37-31(36)32-27-14-16-29(17-15-27)38-24-28(35)23-33-18-20-34(21-19-33)30(25-10-6-4-7-11-25)26-12-8-5-9-13-26/h4-17,28,30,35H,2-3,18-24H2,1H3,(H,32,36) |
| InChIKey | WQRKOOAVGAEFBE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|