C34H37N3O3 — CID 72705144
2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-N-(4-methylphenyl)benzamide (PubChem CID 72705144) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-N-(4-methylphenyl)benzamide.
| Compound Name | 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 72705144 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2OCC(O)CN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C34H37N3O3/c1-26-16-18-29(19-17-26)35-34(39)31-14-8-9-15-32(31)40-25-30(38)24-36-20-22-37(23-21-36)33(27-10-4-2-5-11-27)28-12-6-3-7-13-28/h2-19,30,33,38H,20-25H2,1H3,(H,35,39) |
| InChIKey | ZPTINVLTBADDMU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |