C50H66N4O6 — CID 99687826
bis[(2R)-3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropyl] decanedioate (PubChem CID 99687826) has the molecular formula C50H66N4O6 and a molecular weight of 819.10 g/mol. Its IUPAC name is bis[(2R)-3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropyl] decanedioate.
| Compound Name | bis[(2R)-3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropyl] decanedioate |
|---|---|
| PubChem CID | 99687826 |
| Molecular Formula | C50H66N4O6 |
| Molecular Weight | 819.10 g/mol |
| Exact Mass | 818.50 |
| IUPAC Name | bis[(2R)-3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropyl] decanedioate |
| SMILES | O=C(CCCCCCCCC(=O)OC[C@H](O)CN1CCN(C(c2ccccc2)c2ccccc2)CC1)OC[C@H](O)CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C50H66N4O6/c55-45(37-51-29-33-53(34-30-51)49(41-19-9-5-10-20-41)42-21-11-6-12-22-42)39-59-47(57)27-17-3-1-2-4-18-28-48(58)60-40-46(56)38-52-31-35-54(36-32-52)50(43-23-13-7-14-24-43)44-25-15-8-16-26-44/h5-16,19-26,45-46,49-50,55-56H,1-4,17-18,27-40H2/t45-,46-/m1/s1 |
| InChIKey | VKKJJBKCSHHNOL-AWSIMMLFSA-N |
| XLogP | 6.73 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.10 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|