C20H26N4O — CID 5344420
4-[(Z)-[4-(2-methoxyphenyl)piperazin-1-yl]iminomethyl]-N,N-dimethylaniline (PubChem CID 5344420) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 4-[(Z)-[4-(2-methoxyphenyl)piperazin-1-yl]iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(Z)-[4-(2-methoxyphenyl)piperazin-1-yl]iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 5344420 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-[(Z)-[4-(2-methoxyphenyl)piperazin-1-yl]iminomethyl]-N,N-dimethylaniline |
| SMILES | COc1ccccc1N1CCN(/N=C\c2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H26N4O/c1-22(2)18-10-8-17(9-11-18)16-21-24-14-12-23(13-15-24)19-6-4-5-7-20(19)25-3/h4-11,16H,12-15H2,1-3H3/b21-16- |
| InChIKey | WUTRXVOJLOUWFC-PGMHBOJBSA-N |
| XLogP | 2.92 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|