C20H22ClN3O — CID 6878409
(E,Z)-2-chloro-N-[4-(2-methoxyphenyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine (PubChem CID 6878409) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is (E,Z)-2-chloro-N-[4-(2-methoxyphenyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine.
| Compound Name | (E,Z)-2-chloro-N-[4-(2-methoxyphenyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6878409 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (E,Z)-2-chloro-N-[4-(2-methoxyphenyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine |
| SMILES | COc1ccccc1N1CCN(/N=C/C(Cl)=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22ClN3O/c1-25-20-10-6-5-9-19(20)23-11-13-24(14-12-23)22-16-18(21)15-17-7-3-2-4-8-17/h2-10,15-16H,11-14H2,1H3/b18-15-,22-16+ |
| InChIKey | CJMNNPHUGBJINN-MXXLVYNCSA-N |
| XLogP | 4.08 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|