C27H37N3O5 — CID 11123714
(1R,2R,6R,7S)-1-ethoxy-4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 11123714) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is (1R,2R,6R,7S)-1-ethoxy-4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | (1R,2R,6R,7S)-1-ethoxy-4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 11123714 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (1R,2R,6R,7S)-1-ethoxy-4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | CCO[C@]12CC[C@H](C(=O)C1)[C@H]1C(=O)N(CCCCN3CCN(c4ccccc4OC)CC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C27H37N3O5/c1-3-35-27-11-10-19(21(31)18-27)23-24(27)26(33)30(25(23)32)13-7-6-12-28-14-16-29(17-15-28)20-8-4-5-9-22(20)34-2/h4-5,8-9,19,23-24H,3,6-7,10-18H2,1-2H3/t19-,23-,24+,27-/m1/s1 |
| InChIKey | LXYMAMBIGFXLBY-ISQSTOEMSA-N |
| XLogP | 2.36 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|