C20H27N3O4 — CID 69499695
2-[4-[3-(2,6-dioxopiperidin-1-yl)propyl]piperazin-1-yl]-2-phenylacetic acid (PubChem CID 69499695) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[4-[3-(2,6-dioxopiperidin-1-yl)propyl]piperazin-1-yl]-2-phenylacetic acid.
| Compound Name | 2-[4-[3-(2,6-dioxopiperidin-1-yl)propyl]piperazin-1-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 69499695 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-[4-[3-(2,6-dioxopiperidin-1-yl)propyl]piperazin-1-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1CCN(CCCN2C(=O)CCCC2=O)CC1 |
| InChI | InChI=1S/C20H27N3O4/c24-17-8-4-9-18(25)23(17)11-5-10-21-12-14-22(15-13-21)19(20(26)27)16-6-2-1-3-7-16/h1-3,6-7,19H,4-5,8-15H2,(H,26,27) |
| InChIKey | JICOWHZKSSWHBS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|