C11H11NO3 — CID 156875681
2-(2-oxoazetidin-1-yl)-2-phenylacetic acid (PubChem CID 156875681) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(2-oxoazetidin-1-yl)-2-phenylacetic acid.
| Compound Name | 2-(2-oxoazetidin-1-yl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 156875681 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(2-oxoazetidin-1-yl)-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1CCC1=O |
| InChI | InChI=1S/C11H11NO3/c13-9-6-7-12(9)10(11(14)15)8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,14,15) |
| InChIKey | VHYPISIYQNOBKP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |