C19H24N2O4 — CID 99638802
(3R)-1-[(2S)-2-(2-oxopiperidin-1-yl)-2-phenylacetyl]piperidine-3-carboxylic acid (PubChem CID 99638802) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3R)-1-[(2S)-2-(2-oxopiperidin-1-yl)-2-phenylacetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(2S)-2-(2-oxopiperidin-1-yl)-2-phenylacetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 99638802 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (3R)-1-[(2S)-2-(2-oxopiperidin-1-yl)-2-phenylacetyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(C(=O)[C@H](c2ccccc2)N2CCCCC2=O)C1 |
| InChI | InChI=1S/C19H24N2O4/c22-16-10-4-5-12-21(16)17(14-7-2-1-3-8-14)18(23)20-11-6-9-15(13-20)19(24)25/h1-3,7-8,15,17H,4-6,9-13H2,(H,24,25)/t15-,17+/m1/s1 |
| InChIKey | KRHJBYYEDQUWKZ-WBVHZDCISA-N |
| XLogP | 2.06 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |