C18H22F2N2O3 — CID 119038037
1-[2-[2-(difluoromethyl)morpholin-4-yl]-2-oxo-1-phenylethyl]piperidin-2-one (PubChem CID 119038037) has the molecular formula C18H22F2N2O3 and a molecular weight of 352.38 g/mol. Its IUPAC name is 1-[2-[2-(difluoromethyl)morpholin-4-yl]-2-oxo-1-phenylethyl]piperidin-2-one.
| Compound Name | 1-[2-[2-(difluoromethyl)morpholin-4-yl]-2-oxo-1-phenylethyl]piperidin-2-one |
|---|---|
| PubChem CID | 119038037 |
| Molecular Formula | C18H22F2N2O3 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[2-[2-(difluoromethyl)morpholin-4-yl]-2-oxo-1-phenylethyl]piperidin-2-one |
| SMILES | O=C(C(c1ccccc1)N1CCCCC1=O)N1CCOC(C(F)F)C1 |
| InChI | InChI=1S/C18H22F2N2O3/c19-17(20)14-12-21(10-11-25-14)18(24)16(13-6-2-1-3-7-13)22-9-5-4-8-15(22)23/h1-3,6-7,14,16-17H,4-5,8-12H2 |
| InChIKey | HPODFBVEKBXWOG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |