C27H29N3O4S — CID 56514902
1-[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxo-1-phenylethyl]piperidin-2-one (PubChem CID 56514902) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 1-[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxo-1-phenylethyl]piperidin-2-one.
| Compound Name | 1-[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxo-1-phenylethyl]piperidin-2-one |
|---|---|
| PubChem CID | 56514902 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1-[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxo-1-phenylethyl]piperidin-2-one |
| SMILES | O=C(C(c1ccccc1)N1CCCCC1=O)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C27H29N3O4S/c31-25-12-6-7-15-30(25)26(22-9-2-1-3-10-22)27(32)28-16-18-29(19-17-28)35(33,34)24-14-13-21-8-4-5-11-23(21)20-24/h1-5,8-11,13-14,20,26H,6-7,12,15-19H2 |
| InChIKey | JYPSPVGNTKIHIU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |