C21H32ClN3O3 — CID 119663039
1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxo-1-phenylethyl]piperidin-2-one;hydrochloride (PubChem CID 119663039) has the molecular formula C21H32ClN3O3 and a molecular weight of 409.96 g/mol. Its IUPAC name is 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxo-1-phenylethyl]piperidin-2-one;hydrochloride.
| Compound Name | 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxo-1-phenylethyl]piperidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119663039 |
| Molecular Formula | C21H32ClN3O3 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxo-1-phenylethyl]piperidin-2-one;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)C(c2ccccc2)N2CCCCC2=O)CC1 |
| InChI | InChI=1S/C21H31N3O3.ClH/c22-12-6-16-27-18-10-14-23(15-11-18)21(26)20(17-7-2-1-3-8-17)24-13-5-4-9-19(24)25;/h1-3,7-8,18,20H,4-6,9-16,22H2;1H |
| InChIKey | VGPNPUUWNGOKOU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|