C20H33ClN2O2S — CID 119663139
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-benzylsulfanyl-3-methylbutan-1-one;hydrochloride (PubChem CID 119663139) has the molecular formula C20H33ClN2O2S and a molecular weight of 401.02 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-benzylsulfanyl-3-methylbutan-1-one;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-benzylsulfanyl-3-methylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119663139 |
| Molecular Formula | C20H33ClN2O2S |
| Molecular Weight | 401.02 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-benzylsulfanyl-3-methylbutan-1-one;hydrochloride |
| SMILES | CC(C)C(SCc1ccccc1)C(=O)N1CCC(OCCCN)CC1.Cl |
| InChI | InChI=1S/C20H32N2O2S.ClH/c1-16(2)19(25-15-17-7-4-3-5-8-17)20(23)22-12-9-18(10-13-22)24-14-6-11-21;/h3-5,7-8,16,18-19H,6,9-15,21H2,1-2H3;1H |
| InChIKey | ATMVAMAZHSJOJW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.02 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|