C20H31ClN6O2 — CID 119661883
1-[4-(3-aminopropoxy)piperidin-1-yl]-3-methyl-2-(5-phenyltetrazol-2-yl)butan-1-one;hydrochloride (PubChem CID 119661883) has the molecular formula C20H31ClN6O2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-methyl-2-(5-phenyltetrazol-2-yl)butan-1-one;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-methyl-2-(5-phenyltetrazol-2-yl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119661883 |
| Molecular Formula | C20H31ClN6O2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-methyl-2-(5-phenyltetrazol-2-yl)butan-1-one;hydrochloride |
| SMILES | CC(C)C(C(=O)N1CCC(OCCCN)CC1)n1nnc(-c2ccccc2)n1.Cl |
| InChI | InChI=1S/C20H30N6O2.ClH/c1-15(2)18(26-23-19(22-24-26)16-7-4-3-5-8-16)20(27)25-12-9-17(10-13-25)28-14-6-11-21;/h3-5,7-8,15,17-18H,6,9-14,21H2,1-2H3;1H |
| InChIKey | NQPAOOFBTIDQEV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|