C19H25N5O3 — CID 122119830
5-methyl-1-[3-methyl-2-(5-phenyltetrazol-2-yl)butanoyl]piperidine-3-carboxylic acid (PubChem CID 122119830) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-methyl-1-[3-methyl-2-(5-phenyltetrazol-2-yl)butanoyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[3-methyl-2-(5-phenyltetrazol-2-yl)butanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122119830 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 5-methyl-1-[3-methyl-2-(5-phenyltetrazol-2-yl)butanoyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)C(C(C)C)n2nnc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C19H25N5O3/c1-12(2)16(18(25)23-10-13(3)9-15(11-23)19(26)27)24-21-17(20-22-24)14-7-5-4-6-8-14/h4-8,12-13,15-16H,9-11H2,1-3H3,(H,26,27) |
| InChIKey | IYCRTQOICLJAJG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |