C20H30FN3O3 — CID 119662392
N-[1-[4-(3-aminopropoxy)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 119662392) has the molecular formula C20H30FN3O3 and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[1-[4-(3-aminopropoxy)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[4-(3-aminopropoxy)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 119662392 |
| Molecular Formula | C20H30FN3O3 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[1-[4-(3-aminopropoxy)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)N1CCC(OCCCN)CC1 |
| InChI | InChI=1S/C20H30FN3O3/c1-14(2)18(23-19(25)16-6-3-4-7-17(16)21)20(26)24-11-8-15(9-12-24)27-13-5-10-22/h3-4,6-7,14-15,18H,5,8-13,22H2,1-2H3,(H,23,25) |
| InChIKey | QXRMVBOBZJCPPR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|