C14H15NO3 — CID 12698989
2-(3-methylidene-2-oxopiperidin-1-yl)-2-phenylacetic acid (PubChem CID 12698989) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(3-methylidene-2-oxopiperidin-1-yl)-2-phenylacetic acid.
| Compound Name | 2-(3-methylidene-2-oxopiperidin-1-yl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 12698989 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-(3-methylidene-2-oxopiperidin-1-yl)-2-phenylacetic acid |
| SMILES | C=C1CCCN(C(C(=O)O)c2ccccc2)C1=O |
| InChI | InChI=1S/C14H15NO3/c1-10-6-5-9-15(13(10)16)12(14(17)18)11-7-3-2-4-8-11/h2-4,7-8,12H,1,5-6,9H2,(H,17,18) |
| InChIKey | RTXKHNCMHJDBDN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|