C21H29N3O4 — CID 91333736
[1-[3-(2,6-dioxopiperidin-1-yl)propyl]piperidin-4-yl] N-benzylcarbamate (PubChem CID 91333736) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is [1-[3-(2,6-dioxopiperidin-1-yl)propyl]piperidin-4-yl] N-benzylcarbamate.
| Compound Name | [1-[3-(2,6-dioxopiperidin-1-yl)propyl]piperidin-4-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 91333736 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [1-[3-(2,6-dioxopiperidin-1-yl)propyl]piperidin-4-yl] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OC1CCN(CCCN2C(=O)CCCC2=O)CC1 |
| InChI | InChI=1S/C21H29N3O4/c25-19-8-4-9-20(26)24(19)13-5-12-23-14-10-18(11-15-23)28-21(27)22-16-17-6-2-1-3-7-17/h1-3,6-7,18H,4-5,8-16H2,(H,22,27) |
| InChIKey | DLZHHSCADBLPHG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|