C16H19F2NO2 — CID 177145440
(2,2-difluorospiro[2.5]octan-6-yl) N-benzylcarbamate (PubChem CID 177145440) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is (2,2-difluorospiro[2.5]octan-6-yl) N-benzylcarbamate.
| Compound Name | (2,2-difluorospiro[2.5]octan-6-yl) N-benzylcarbamate |
|---|---|
| PubChem CID | 177145440 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2,2-difluorospiro[2.5]octan-6-yl) N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OC1CCC2(CC1)CC2(F)F |
| InChI | InChI=1S/C16H19F2NO2/c17-16(18)11-15(16)8-6-13(7-9-15)21-14(20)19-10-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,19,20) |
| InChIKey | CDWXXTGHAJQKTD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |