C16H22N2O3 — CID 107654733
1-oxa-8-azaspiro[4.5]decan-3-yl N-benzylcarbamate (PubChem CID 107654733) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-oxa-8-azaspiro[4.5]decan-3-yl N-benzylcarbamate.
| Compound Name | 1-oxa-8-azaspiro[4.5]decan-3-yl N-benzylcarbamate |
|---|---|
| PubChem CID | 107654733 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-oxa-8-azaspiro[4.5]decan-3-yl N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OC1COC2(CCNCC2)C1 |
| InChI | InChI=1S/C16H22N2O3/c19-15(18-11-13-4-2-1-3-5-13)21-14-10-16(20-12-14)6-8-17-9-7-16/h1-5,14,17H,6-12H2,(H,18,19) |
| InChIKey | QAWJDHVGZPRIDT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |