About 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate
1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate (PubChem CID 102930707) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate.
Molecular Properties
| Compound Name | 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate |
| PubChem CID | 102930707 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate |
| SMILES | O=C(NC1CCC1)OC1COC2(CCNCC2)C1 |
| InChI | InChI=1S/C13H22N2O3/c16-12(15-10-2-1-3-10)18-11-8-13(17-9-11)4-6-14-7-5-13/h10-11,14H,1-9H2,(H,15,16) |
| InChIKey | PKNKHYUGTPROIL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate?
The IUPAC name of 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate (CID 102930707) is 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate.
What is the SMILES notation for 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate?
The canonical SMILES for 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate is O=C(NC1CCC1)OC1COC2(CCNCC2)C1.
What is the InChIKey of 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate?
The InChIKey is PKNKHYUGTPROIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3/c16-12(15-10-2-1-3-10)18-11-8-13(17-9-11)4-6-14-7-5-13/h10-11,14H,1-9H2,(H,15,16).
What are the key properties of 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate?
1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate has a molecular weight of 254.33 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxa-8-azaspiro[4.5]decan-3-yl N-cyclobutylcarbamate is sourced from PubChem (CID 102930707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).