C11H20N2O3 — CID 102930688
1-oxa-8-azaspiro[4.5]decan-3-yl N,N-dimethylcarbamate (PubChem CID 102930688) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-oxa-8-azaspiro[4.5]decan-3-yl N,N-dimethylcarbamate.
| Compound Name | 1-oxa-8-azaspiro[4.5]decan-3-yl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 102930688 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-oxa-8-azaspiro[4.5]decan-3-yl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC1COC2(CCNCC2)C1 |
| InChI | InChI=1S/C11H20N2O3/c1-13(2)10(14)16-9-7-11(15-8-9)3-5-12-6-4-11/h9,12H,3-8H2,1-2H3 |
| InChIKey | BUCCKUKIQUJLGE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |