C22H29N3O2 — CID 69474634
[3-[1-(3-aminopropyl)piperidin-4-yl]phenyl] N-benzylcarbamate (PubChem CID 69474634) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is [3-[1-(3-aminopropyl)piperidin-4-yl]phenyl] N-benzylcarbamate.
| Compound Name | [3-[1-(3-aminopropyl)piperidin-4-yl]phenyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 69474634 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | [3-[1-(3-aminopropyl)piperidin-4-yl]phenyl] N-benzylcarbamate |
| SMILES | NCCCN1CCC(c2cccc(OC(=O)NCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H29N3O2/c23-12-5-13-25-14-10-19(11-15-25)20-8-4-9-21(16-20)27-22(26)24-17-18-6-2-1-3-7-18/h1-4,6-9,16,19H,5,10-15,17,23H2,(H,24,26) |
| InChIKey | UZYSNTILARRWNK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |