C30H34N2O3 — CID 22049519
2-(3-methoxyphenyl)-N-[3-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]phenyl]acetamide (PubChem CID 22049519) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[3-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]phenyl]acetamide.
| Compound Name | 2-(3-methoxyphenyl)-N-[3-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 22049519 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[3-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]phenyl]acetamide |
| SMILES | COc1cccc(CC(=O)Nc2cccc(C3CCN(CCCC(=O)c4ccccc4)CC3)c2)c1 |
| InChI | InChI=1S/C30H34N2O3/c1-35-28-13-5-8-23(20-28)21-30(34)31-27-12-6-11-26(22-27)24-15-18-32(19-16-24)17-7-14-29(33)25-9-3-2-4-10-25/h2-6,8-13,20,22,24H,7,14-19,21H2,1H3,(H,31,34) |
| InChIKey | UMNHSSOLDUFTFF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |