C32H39N3O6 — CID 22911542
4-[3-[5-[4-(3-methoxyphenyl)piperidin-1-yl]pentanoylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 22911542) has the molecular formula C32H39N3O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is 4-[3-[5-[4-(3-methoxyphenyl)piperidin-1-yl]pentanoylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[3-[5-[4-(3-methoxyphenyl)piperidin-1-yl]pentanoylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 22911542 |
| Molecular Formula | C32H39N3O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 4-[3-[5-[4-(3-methoxyphenyl)piperidin-1-yl]pentanoylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | COc1cccc(C2CCN(CCCCC(=O)Nc3cccc(C4C(C(=O)O)=C(C)NC(C)=C4C(=O)O)c3)CC2)c1 |
| InChI | InChI=1S/C32H39N3O6/c1-20-28(31(37)38)30(29(32(39)40)21(2)33-20)24-9-6-10-25(18-24)34-27(36)12-4-5-15-35-16-13-22(14-17-35)23-8-7-11-26(19-23)41-3/h6-11,18-19,22,30,33H,4-5,12-17H2,1-3H3,(H,34,36)(H,37,38)(H,39,40) |
| InChIKey | LSTFAIADLINDCE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|