C37H47N4O4+ — CID 20625191
5-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]pentyl-[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium (PubChem CID 20625191) has the molecular formula C37H47N4O4+ and a molecular weight of 611.81 g/mol. Its IUPAC name is 5-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]pentyl-[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium.
| Compound Name | 5-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]pentyl-[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 20625191 |
| Molecular Formula | C37H47N4O4+ |
| Molecular Weight | 611.81 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | 5-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]pentyl-[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCCN1CCC(OC(=O)NC(c2ccccc2)c2ccccc2)CC1)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H46N4O4/c1-41(2,28-14-24-40-35(42)32-19-10-11-20-33(32)36(40)43)27-13-5-12-23-39-25-21-31(22-26-39)45-37(44)38-34(29-15-6-3-7-16-29)30-17-8-4-9-18-30/h3-4,6-11,15-20,31,34H,5,12-14,21-28H2,1-2H3/p+1 |
| InChIKey | VEYRVUJIYGENSL-UHFFFAOYSA-O |
| XLogP | 5.90 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.81 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|