C43H64N3O4+ — CID 20625248
8-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]octyl-[6-[(2-methoxyphenyl)methoxy]hexyl]-dimethylazanium (PubChem CID 20625248) has the molecular formula C43H64N3O4+ and a molecular weight of 687.00 g/mol. Its IUPAC name is 8-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]octyl-[6-[(2-methoxyphenyl)methoxy]hexyl]-dimethylazanium.
| Compound Name | 8-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]octyl-[6-[(2-methoxyphenyl)methoxy]hexyl]-dimethylazanium |
|---|---|
| PubChem CID | 20625248 |
| Molecular Formula | C43H64N3O4+ |
| Molecular Weight | 687.00 g/mol |
| Exact Mass | 686.49 |
| IUPAC Name | 8-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]octyl-[6-[(2-methoxyphenyl)methoxy]hexyl]-dimethylazanium |
| SMILES | COc1ccccc1COCCCCCC[N+](C)(C)CCCCCCCCN1CCC(OC(=O)NC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C43H63N3O4/c1-46(2,34-20-8-9-21-35-49-36-39-26-16-17-27-41(39)48-3)33-19-7-5-4-6-18-30-45-31-28-40(29-32-45)50-43(47)44-42(37-22-12-10-13-23-37)38-24-14-11-15-25-38/h10-17,22-27,40,42H,4-9,18-21,28-36H2,1-3H3/p+1 |
| InChIKey | STSWYUMLYQBAMR-UHFFFAOYSA-O |
| XLogP | 9.17 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.00 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|