C45H60N3O3+ — CID 70947270
6-[(2-methoxyphenyl)methoxy]hexyl-dimethyl-[2-[N-[2-[3-(2-oxo-1,1-diphenylpropyl)pyrrolidin-1-yl]ethyl]anilino]ethyl]azanium (PubChem CID 70947270) has the molecular formula C45H60N3O3+ and a molecular weight of 690.99 g/mol. Its IUPAC name is 6-[(2-methoxyphenyl)methoxy]hexyl-dimethyl-[2-[N-[2-[3-(2-oxo-1,1-diphenylpropyl)pyrrolidin-1-yl]ethyl]anilino]ethyl]azanium.
| Compound Name | 6-[(2-methoxyphenyl)methoxy]hexyl-dimethyl-[2-[N-[2-[3-(2-oxo-1,1-diphenylpropyl)pyrrolidin-1-yl]ethyl]anilino]ethyl]azanium |
|---|---|
| PubChem CID | 70947270 |
| Molecular Formula | C45H60N3O3+ |
| Molecular Weight | 690.99 g/mol |
| Exact Mass | 690.46 |
| IUPAC Name | 6-[(2-methoxyphenyl)methoxy]hexyl-dimethyl-[2-[N-[2-[3-(2-oxo-1,1-diphenylpropyl)pyrrolidin-1-yl]ethyl]anilino]ethyl]azanium |
| SMILES | COc1ccccc1COCCCCCC[N+](C)(C)CCN(CCN1CCC(C(C(C)=O)(c2ccccc2)c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C45H60N3O3/c1-38(49)45(40-21-10-7-11-22-40,41-23-12-8-13-24-41)42-28-29-46(36-42)30-31-47(43-25-14-9-15-26-43)32-34-48(2,3)33-18-5-6-19-35-51-37-39-20-16-17-27-44(39)50-4/h7-17,20-27,42H,5-6,18-19,28-37H2,1-4H3/q+1 |
| InChIKey | BNZKGTYMEHGBAN-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.99 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|