C49H67N4O4+ — CID 58002105
2-[N-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]-4-(3-carboxypropyl)anilino]ethyl-[8-(2-methoxyphenyl)octyl]-dimethylazanium (PubChem CID 58002105) has the molecular formula C49H67N4O4+ and a molecular weight of 776.10 g/mol. Its IUPAC name is 2-[N-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]-4-(3-carboxypropyl)anilino]ethyl-[8-(2-methoxyphenyl)octyl]-dimethylazanium.
| Compound Name | 2-[N-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]-4-(3-carboxypropyl)anilino]ethyl-[8-(2-methoxyphenyl)octyl]-dimethylazanium |
|---|---|
| PubChem CID | 58002105 |
| Molecular Formula | C49H67N4O4+ |
| Molecular Weight | 776.10 g/mol |
| Exact Mass | 775.52 |
| IUPAC Name | 2-[N-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]-4-(3-carboxypropyl)anilino]ethyl-[8-(2-methoxyphenyl)octyl]-dimethylazanium |
| SMILES | COc1ccccc1CCCCCCCC[N+](C)(C)CCN(CCN1CCC(C(C(N)=O)(c2ccccc2)c2ccccc2)C1)c1ccc(CCCC(=O)O)cc1 |
| InChI | InChI=1S/C49H66N4O4/c1-53(2,37-17-7-5-4-6-10-20-41-21-15-16-26-46(41)57-3)38-36-52(45-30-28-40(29-31-45)19-18-27-47(54)55)35-34-51-33-32-44(39-51)49(48(50)56,42-22-11-8-12-23-42)43-24-13-9-14-25-43/h8-9,11-16,21-26,28-31,44H,4-7,10,17-20,27,32-39H2,1-3H3,(H2-,50,54,55,56)/p+1 |
| InChIKey | DPVKXCWOTHBHMU-UHFFFAOYSA-O |
| XLogP | 8.36 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.10 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|