C38H49N4O3+ — CID 20625241
8-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]octyl-[2-(1,3-dioxoisoindol-2-yl)ethyl]-dimethylazanium (PubChem CID 20625241) has the molecular formula C38H49N4O3+ and a molecular weight of 609.84 g/mol. Its IUPAC name is 8-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]octyl-[2-(1,3-dioxoisoindol-2-yl)ethyl]-dimethylazanium.
| Compound Name | 8-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]octyl-[2-(1,3-dioxoisoindol-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 20625241 |
| Molecular Formula | C38H49N4O3+ |
| Molecular Weight | 609.84 g/mol |
| Exact Mass | 609.38 |
| IUPAC Name | 8-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]octyl-[2-(1,3-dioxoisoindol-2-yl)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCCCCCN1CCC(C(C(N)=O)(c2ccccc2)c2ccccc2)C1)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C38H48N4O3/c1-42(2,28-26-41-35(43)33-21-13-14-22-34(33)36(41)44)27-16-6-4-3-5-15-24-40-25-23-32(29-40)38(37(39)45,30-17-9-7-10-18-30)31-19-11-8-12-20-31/h7-14,17-22,32H,3-6,15-16,23-29H2,1-2H3,(H-,39,45)/p+1 |
| InChIKey | PPAUXHBEUFYPED-UHFFFAOYSA-O |
| XLogP | 5.49 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.84 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|