C20H25N3O — CID 66858006
2-[1-(2-aminoethyl)pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 66858006) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[1-(2-aminoethyl)pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[1-(2-aminoethyl)pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 66858006 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-[1-(2-aminoethyl)pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | NCCN1CCC(C(C(N)=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H25N3O/c21-12-14-23-13-11-18(15-23)20(19(22)24,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18H,11-15,21H2,(H2,22,24) |
| InChIKey | KXGWICQIDNUSBB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |