C25H33ClN2O2 — CID 87396933
2-[(3S)-1-(7-oxoheptyl)pyrrolidin-3-yl]-2,2-diphenylacetamide;hydrochloride (PubChem CID 87396933) has the molecular formula C25H33ClN2O2 and a molecular weight of 429.00 g/mol. Its IUPAC name is 2-[(3S)-1-(7-oxoheptyl)pyrrolidin-3-yl]-2,2-diphenylacetamide;hydrochloride.
| Compound Name | 2-[(3S)-1-(7-oxoheptyl)pyrrolidin-3-yl]-2,2-diphenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 87396933 |
| Molecular Formula | C25H33ClN2O2 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-[(3S)-1-(7-oxoheptyl)pyrrolidin-3-yl]-2,2-diphenylacetamide;hydrochloride |
| SMILES | Cl.NC(=O)C(c1ccccc1)(c1ccccc1)[C@@H]1CCN(CCCCCCC=O)C1 |
| InChI | InChI=1S/C25H32N2O2.ClH/c26-24(29)25(21-12-6-4-7-13-21,22-14-8-5-9-15-22)23-16-18-27(20-23)17-10-2-1-3-11-19-28;/h4-9,12-15,19,23H,1-3,10-11,16-18,20H2,(H2,26,29);1H/t23-;/m1./s1 |
| InChIKey | JSODSGIFEATQHY-GNAFDRTKSA-N |
| XLogP | 4.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|