C26H37N3O — CID 11600092
2-[(3R)-1-[7-(methylamino)heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 11600092) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 2-[(3R)-1-[7-(methylamino)heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3R)-1-[7-(methylamino)heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 11600092 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 2-[(3R)-1-[7-(methylamino)heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | CNCCCCCCCN1CC[C@H](C(C(N)=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H37N3O/c1-28-18-11-3-2-4-12-19-29-20-17-24(21-29)26(25(27)30,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-10,13-16,24,28H,2-4,11-12,17-21H2,1H3,(H2,27,30)/t24-/m0/s1 |
| InChIKey | ZVJNCGUBCXLMCW-DEOSSOPVSA-N |
| XLogP | 3.95 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|