C28H40N4O2 — CID 143136786
2-[1-[5-[[2-(dimethylamino)acetyl]amino]pentyl]piperidin-4-yl]-2,2-diphenylacetamide (PubChem CID 143136786) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is 2-[1-[5-[[2-(dimethylamino)acetyl]amino]pentyl]piperidin-4-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[1-[5-[[2-(dimethylamino)acetyl]amino]pentyl]piperidin-4-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 143136786 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | 2-[1-[5-[[2-(dimethylamino)acetyl]amino]pentyl]piperidin-4-yl]-2,2-diphenylacetamide |
| SMILES | CN(C)CC(=O)NCCCCCN1CCC(C(C(N)=O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H40N4O2/c1-31(2)22-26(33)30-18-10-5-11-19-32-20-16-25(17-21-32)28(27(29)34,23-12-6-3-7-13-23)24-14-8-4-9-15-24/h3-4,6-9,12-15,25H,5,10-11,16-22H2,1-2H3,(H2,29,34)(H,30,33) |
| InChIKey | NMYNQUBCUWMTLB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|