C30H45N3O2 — CID 11306139
2-[(3R)-1-[9-[[(2S)-1-hydroxypropan-2-yl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 11306139) has the molecular formula C30H45N3O2 and a molecular weight of 479.71 g/mol. Its IUPAC name is 2-[(3R)-1-[9-[[(2S)-1-hydroxypropan-2-yl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3R)-1-[9-[[(2S)-1-hydroxypropan-2-yl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 11306139 |
| Molecular Formula | C30H45N3O2 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.35 |
| IUPAC Name | 2-[(3R)-1-[9-[[(2S)-1-hydroxypropan-2-yl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | C[C@@H](CO)NCCCCCCCCCN1CC[C@H](C(C(N)=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C30H45N3O2/c1-25(24-34)32-20-13-5-3-2-4-6-14-21-33-22-19-28(23-33)30(29(31)35,26-15-9-7-10-16-26)27-17-11-8-12-18-27/h7-12,15-18,25,28,32,34H,2-6,13-14,19-24H2,1H3,(H2,31,35)/t25-,28-/m0/s1 |
| InChIKey | GCFMVIUMXAOANP-LSYYVWMOSA-N |
| XLogP | 4.48 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|