C26H40N4O2 — CID 143136784
(3E,5Z)-2-[1-[5-[(2-aminoacetyl)amino]pentyl]pyrrolidin-3-yl]-3-ethyl-2-phenylhepta-3,5-dienamide (PubChem CID 143136784) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is (3E,5Z)-2-[1-[5-[(2-aminoacetyl)amino]pentyl]pyrrolidin-3-yl]-3-ethyl-2-phenylhepta-3,5-dienamide.
| Compound Name | (3E,5Z)-2-[1-[5-[(2-aminoacetyl)amino]pentyl]pyrrolidin-3-yl]-3-ethyl-2-phenylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 143136784 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | (3E,5Z)-2-[1-[5-[(2-aminoacetyl)amino]pentyl]pyrrolidin-3-yl]-3-ethyl-2-phenylhepta-3,5-dienamide |
| SMILES | C/C=C\C=C(/CC)C(C(N)=O)(c1ccccc1)C1CCN(CCCCCNC(=O)CN)C1 |
| InChI | InChI=1S/C26H40N4O2/c1-3-5-12-21(4-2)26(25(28)32,22-13-8-6-9-14-22)23-15-18-30(20-23)17-11-7-10-16-29-24(31)19-27/h3,5-6,8-9,12-14,23H,4,7,10-11,15-20,27H2,1-2H3,(H2,28,32)(H,29,31)/b5-3-,21-12+ |
| InChIKey | LAOYONXYKKUHFP-SQHXTBOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|