C20H26N2O — CID 143136785
(3E,5Z)-3-ethenyl-2-(1-methylpyrrolidin-3-yl)-2-phenylhepta-3,5-dienamide (PubChem CID 143136785) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-2-(1-methylpyrrolidin-3-yl)-2-phenylhepta-3,5-dienamide.
| Compound Name | (3E,5Z)-3-ethenyl-2-(1-methylpyrrolidin-3-yl)-2-phenylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 143136785 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (3E,5Z)-3-ethenyl-2-(1-methylpyrrolidin-3-yl)-2-phenylhepta-3,5-dienamide |
| SMILES | C=C/C(=C\C=C/C)C(C(N)=O)(c1ccccc1)C1CCN(C)C1 |
| InChI | InChI=1S/C20H26N2O/c1-4-6-10-16(5-2)20(19(21)23,17-11-8-7-9-12-17)18-13-14-22(3)15-18/h4-12,18H,2,13-15H2,1,3H3,(H2,21,23)/b6-4-,16-10+ |
| InChIKey | WSPCZEZQFAOEEM-OGTPZPDLSA-N |
| XLogP | 3.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|