C8H14Br2N2O — CID 141011874
2,2-dibromo-2-(1-methylpiperidin-4-yl)acetamide (PubChem CID 141011874) has the molecular formula C8H14Br2N2O and a molecular weight of 314.02 g/mol. Its IUPAC name is 2,2-dibromo-2-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2,2-dibromo-2-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 141011874 |
| Molecular Formula | C8H14Br2N2O |
| Molecular Weight | 314.02 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 2,2-dibromo-2-(1-methylpiperidin-4-yl)acetamide |
| SMILES | CN1CCC(C(Br)(Br)C(N)=O)CC1 |
| InChI | InChI=1S/C8H14Br2N2O/c1-12-4-2-6(3-5-12)8(9,10)7(11)13/h6H,2-5H2,1H3,(H2,11,13) |
| InChIKey | RHLBYDRUJRUEDH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.02 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|