C20H27NO — CID 142195897
(2E,3Z)-2-ethylidene-1-(1-methylpiperidin-4-yl)-1-phenylhexa-3,5-dien-1-ol (PubChem CID 142195897) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-1-(1-methylpiperidin-4-yl)-1-phenylhexa-3,5-dien-1-ol.
| Compound Name | (2E,3Z)-2-ethylidene-1-(1-methylpiperidin-4-yl)-1-phenylhexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 142195897 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (2E,3Z)-2-ethylidene-1-(1-methylpiperidin-4-yl)-1-phenylhexa-3,5-dien-1-ol |
| SMILES | C=C/C=C\C(=C/C)C(O)(c1ccccc1)C1CCN(C)CC1 |
| InChI | InChI=1S/C20H27NO/c1-4-6-10-17(5-2)20(22,18-11-8-7-9-12-18)19-13-15-21(3)16-14-19/h4-12,19,22H,1,13-16H2,2-3H3/b10-6-,17-5+ |
| InChIKey | WNGMDURVDXWPMC-MDYRNCONSA-N |
| XLogP | 3.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|