C23H28 — CID 163276575
ethane;[(3E,5Z)-3-ethenyl-2-phenylhepta-3,5-dien-2-yl]benzene (PubChem CID 163276575) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is ethane;[(3E,5Z)-3-ethenyl-2-phenylhepta-3,5-dien-2-yl]benzene.
| Compound Name | ethane;[(3E,5Z)-3-ethenyl-2-phenylhepta-3,5-dien-2-yl]benzene |
|---|---|
| PubChem CID | 163276575 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | ethane;[(3E,5Z)-3-ethenyl-2-phenylhepta-3,5-dien-2-yl]benzene |
| SMILES | C=C/C(=C\C=C/C)C(C)(c1ccccc1)c1ccccc1.CC |
| InChI | InChI=1S/C21H22.C2H6/c1-4-6-13-18(5-2)21(3,19-14-9-7-10-15-19)20-16-11-8-12-17-20;1-2/h4-17H,2H2,1,3H3;1-2H3/b6-4-,18-13+; |
| InChIKey | QGMPURSHMRZUFD-ZXJQMLAYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|