C16H18O — CID 88999679
(3E,5Z)-3-ethenyl-2-methyl-2-phenylhepta-3,5-dienal (PubChem CID 88999679) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-2-methyl-2-phenylhepta-3,5-dienal.
| Compound Name | (3E,5Z)-3-ethenyl-2-methyl-2-phenylhepta-3,5-dienal |
|---|---|
| PubChem CID | 88999679 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (3E,5Z)-3-ethenyl-2-methyl-2-phenylhepta-3,5-dienal |
| SMILES | C=C/C(=C\C=C/C)C(C)(C=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O/c1-4-6-10-14(5-2)16(3,13-17)15-11-8-7-9-12-15/h4-13H,2H2,1,3H3/b6-4-,14-10+ |
| InChIKey | WAJBADJREQKKQL-YFXJVGCVSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|