C35H36O — CID 126516005
1-[(2Z,4E,7E,9E)-5-ethenyl-6-phenyl-7-[(Z)-3-phenylprop-1-enyl]undeca-2,4,7,9-tetraen-6-yl]-4-methoxybenzene (PubChem CID 126516005) has the molecular formula C35H36O and a molecular weight of 472.67 g/mol. Its IUPAC name is 1-[(2Z,4E,7E,9E)-5-ethenyl-6-phenyl-7-[(Z)-3-phenylprop-1-enyl]undeca-2,4,7,9-tetraen-6-yl]-4-methoxybenzene.
| Compound Name | 1-[(2Z,4E,7E,9E)-5-ethenyl-6-phenyl-7-[(Z)-3-phenylprop-1-enyl]undeca-2,4,7,9-tetraen-6-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 126516005 |
| Molecular Formula | C35H36O |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1-[(2Z,4E,7E,9E)-5-ethenyl-6-phenyl-7-[(Z)-3-phenylprop-1-enyl]undeca-2,4,7,9-tetraen-6-yl]-4-methoxybenzene |
| SMILES | C=C/C(=C\C=C/C)C(C(/C=C\Cc1ccccc1)=C/C=C/C)(c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C35H36O/c1-5-8-20-30(7-3)35(32-22-14-11-15-23-32,33-25-27-34(36-4)28-26-33)31(21-9-6-2)24-16-19-29-17-12-10-13-18-29/h5-18,20-28H,3,19H2,1-2,4H3/b8-5-,9-6+,24-16-,30-20+,31-21+ |
| InChIKey | HJVHUERXMZSPLZ-PWCBCLKMSA-N |
| XLogP | 8.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|