C26H35NO — CID 144938327
(2E)-1-(4-methoxyphenyl)-1-phenyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;pentane (PubChem CID 144938327) has the molecular formula C26H35NO and a molecular weight of 377.57 g/mol. Its IUPAC name is (2E)-1-(4-methoxyphenyl)-1-phenyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;pentane.
| Compound Name | (2E)-1-(4-methoxyphenyl)-1-phenyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;pentane |
|---|---|
| PubChem CID | 144938327 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | (2E)-1-(4-methoxyphenyl)-1-phenyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;pentane |
| SMILES | C=C/C=C(\C=C/C)C(N)(c1ccccc1)c1ccc(OC)cc1.CCCCC |
| InChI | InChI=1S/C21H23NO.C5H12/c1-4-9-17(10-5-2)21(22,18-11-7-6-8-12-18)19-13-15-20(23-3)16-14-19;1-3-5-4-2/h4-16H,1,22H2,2-3H3;3-5H2,1-2H3/b10-5-,17-9+; |
| InChIKey | MESDAULJBBXHJZ-MLFUFOKMSA-N |
| XLogP | 6.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|